C23H26N2O5S2 — CID 30278307
N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-(N-methylsulfonyl-2-phenoxyanilino)acetamide (PubChem CID 30278307) has the molecular formula C23H26N2O5S2 and a molecular weight of 474.60 g/mol. Its IUPAC name is N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-(N-methylsulfonyl-2-phenoxyanilino)acetamide.
| Compound Name | N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-(N-methylsulfonyl-2-phenoxyanilino)acetamide |
|---|---|
| PubChem CID | 30278307 |
| Molecular Formula | C23H26N2O5S2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | N-[3-(furan-2-ylmethylsulfanyl)propyl]-2-(N-methylsulfonyl-2-phenoxyanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCCSCc1ccco1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C23H26N2O5S2/c1-32(27,28)25(17-23(26)24-14-8-16-31-18-20-11-7-15-29-20)21-12-5-6-13-22(21)30-19-9-3-2-4-10-19/h2-7,9-13,15H,8,14,16-18H2,1H3,(H,24,26) |
| InChIKey | SWSXGNNLMBXTGO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|