C24H25N3O7S — CID 1102369
N-benzyl-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-methylacetamide (PubChem CID 1102369) has the molecular formula C24H25N3O7S and a molecular weight of 499.55 g/mol. Its IUPAC name is N-benzyl-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-methylacetamide.
| Compound Name | N-benzyl-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-methylacetamide |
|---|---|
| PubChem CID | 1102369 |
| Molecular Formula | C24H25N3O7S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | N-benzyl-2-(2,4-dimethoxy-N-(2-nitrophenyl)sulfonylanilino)-N-methylacetamide |
| SMILES | COc1ccc(N(CC(=O)N(C)Cc2ccccc2)S(=O)(=O)c2ccccc2[N+](=O)[O-])c(OC)c1 |
| InChI | InChI=1S/C24H25N3O7S/c1-25(16-18-9-5-4-6-10-18)24(28)17-26(20-14-13-19(33-2)15-22(20)34-3)35(31,32)23-12-8-7-11-21(23)27(29)30/h4-15H,16-17H2,1-3H3 |
| InChIKey | YCZVJAZCRDJOHM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|