C21H27N3O7S — CID 133202570
N-[1-(2,5-dimethoxyphenyl)ethyl]-4-(N-methylsulfonyl-3-nitroanilino)butanamide (PubChem CID 133202570) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is N-[1-(2,5-dimethoxyphenyl)ethyl]-4-(N-methylsulfonyl-3-nitroanilino)butanamide.
| Compound Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-4-(N-methylsulfonyl-3-nitroanilino)butanamide |
|---|---|
| PubChem CID | 133202570 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-[1-(2,5-dimethoxyphenyl)ethyl]-4-(N-methylsulfonyl-3-nitroanilino)butanamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)CCCN(c2cccc([N+](=O)[O-])c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H27N3O7S/c1-15(19-14-18(30-2)10-11-20(19)31-3)22-21(25)9-6-12-23(32(4,28)29)16-7-5-8-17(13-16)24(26)27/h5,7-8,10-11,13-15H,6,9,12H2,1-4H3,(H,22,25) |
| InChIKey | DCXJZNCXBIBRCY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|