C21H27N3O7S — CID 133202122
4-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[1-(2-methoxyphenyl)ethyl]butanamide (PubChem CID 133202122) has the molecular formula C21H27N3O7S and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[1-(2-methoxyphenyl)ethyl]butanamide.
| Compound Name | 4-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[1-(2-methoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 133202122 |
| Molecular Formula | C21H27N3O7S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 4-(2-methoxy-N-methylsulfonyl-5-nitroanilino)-N-[1-(2-methoxyphenyl)ethyl]butanamide |
| SMILES | COc1ccccc1C(C)NC(=O)CCCN(c1cc([N+](=O)[O-])ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C21H27N3O7S/c1-15(17-8-5-6-9-19(17)30-2)22-21(25)10-7-13-23(32(4,28)29)18-14-16(24(26)27)11-12-20(18)31-3/h5-6,8-9,11-12,14-15H,7,10,13H2,1-4H3,(H,22,25) |
| InChIKey | SXGVHDCXBGOEOD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|