C23H29N3O6S — CID 125083696
N-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide (PubChem CID 125083696) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is N-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide.
| Compound Name | N-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide |
|---|---|
| PubChem CID | 125083696 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-[(1R)-1-(2,3-dihydro-1H-inden-5-yl)ethyl]-4-(2-methoxy-N-methylsulfonyl-5-nitroanilino)butanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CCCC(=O)N[C@H](C)c1ccc2c(c1)CCC2)S(C)(=O)=O |
| InChI | InChI=1S/C23H29N3O6S/c1-16(18-10-9-17-6-4-7-19(17)14-18)24-23(27)8-5-13-25(33(3,30)31)21-15-20(26(28)29)11-12-22(21)32-2/h9-12,14-16H,4-8,13H2,1-3H3,(H,24,27)/t16-/m1/s1 |
| InChIKey | NXJBNSGELLVRNQ-MRXNPFEDSA-N |
| XLogP | 3.52 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|