C22H27N3O7S — CID 133230564
N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-(2-methyl-N-methylsulfonyl-5-nitroanilino)butanamide (PubChem CID 133230564) has the molecular formula C22H27N3O7S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-(2-methyl-N-methylsulfonyl-5-nitroanilino)butanamide.
| Compound Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-(2-methyl-N-methylsulfonyl-5-nitroanilino)butanamide |
|---|---|
| PubChem CID | 133230564 |
| Molecular Formula | C22H27N3O7S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-4-(2-methyl-N-methylsulfonyl-5-nitroanilino)butanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N(CCCC(=O)NC(C)c1ccc2c(c1)OCCO2)S(C)(=O)=O |
| InChI | InChI=1S/C22H27N3O7S/c1-15-6-8-18(25(27)28)14-19(15)24(33(3,29)30)10-4-5-22(26)23-16(2)17-7-9-20-21(13-17)32-12-11-31-20/h6-9,13-14,16H,4-5,10-12H2,1-3H3,(H,23,26) |
| InChIKey | GLJWWCVZGBXCAA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|