C21H27ClN2O5S — CID 133163003
4-(3-chloro-N-methylsulfonylanilino)-N-[1-(2,5-dimethoxyphenyl)ethyl]butanamide (PubChem CID 133163003) has the molecular formula C21H27ClN2O5S and a molecular weight of 454.98 g/mol. Its IUPAC name is 4-(3-chloro-N-methylsulfonylanilino)-N-[1-(2,5-dimethoxyphenyl)ethyl]butanamide.
| Compound Name | 4-(3-chloro-N-methylsulfonylanilino)-N-[1-(2,5-dimethoxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 133163003 |
| Molecular Formula | C21H27ClN2O5S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 4-(3-chloro-N-methylsulfonylanilino)-N-[1-(2,5-dimethoxyphenyl)ethyl]butanamide |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)CCCN(c2cccc(Cl)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H27ClN2O5S/c1-15(19-14-18(28-2)10-11-20(19)29-3)23-21(25)9-6-12-24(30(4,26)27)17-8-5-7-16(22)13-17/h5,7-8,10-11,13-15H,6,9,12H2,1-4H3,(H,23,25) |
| InChIKey | HBHQMUXTSVDNQM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |