C23H29NO7S — CID 10718923
ethyl 2-[(4-ethoxy-4-oxobutyl)-(4-methylphenyl)sulfonylamino]-4-methoxybenzoate (PubChem CID 10718923) has the molecular formula C23H29NO7S and a molecular weight of 463.55 g/mol. Its IUPAC name is ethyl 2-[(4-ethoxy-4-oxobutyl)-(4-methylphenyl)sulfonylamino]-4-methoxybenzoate.
| Compound Name | ethyl 2-[(4-ethoxy-4-oxobutyl)-(4-methylphenyl)sulfonylamino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 10718923 |
| Molecular Formula | C23H29NO7S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | ethyl 2-[(4-ethoxy-4-oxobutyl)-(4-methylphenyl)sulfonylamino]-4-methoxybenzoate |
| SMILES | CCOC(=O)CCCN(c1cc(OC)ccc1C(=O)OCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H29NO7S/c1-5-30-22(25)8-7-15-24(32(27,28)19-12-9-17(3)10-13-19)21-16-18(29-4)11-14-20(21)23(26)31-6-2/h9-14,16H,5-8,15H2,1-4H3 |
| InChIKey | XDBQYUPBYQTFIC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |