C22H20Cl2N2O5S — CID 1295229
N-(3,4-dichlorophenyl)-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide (PubChem CID 1295229) has the molecular formula C22H20Cl2N2O5S and a molecular weight of 495.38 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 1295229 |
| Molecular Formula | C22H20Cl2N2O5S |
| Molecular Weight | 495.38 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccc(Cl)c(Cl)c2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H20Cl2N2O5S/c1-30-20-11-9-17(13-21(20)31-2)32(28,29)26(16-6-4-3-5-7-16)14-22(27)25-15-8-10-18(23)19(24)12-15/h3-13H,14H2,1-2H3,(H,25,27) |
| InChIKey | QSVRFMWEJNVSDS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |