C17H20N2O5S — CID 3542360
N-(3,4-dimethoxyphenyl)-2-(N-methylsulfonylanilino)acetamide (PubChem CID 3542360) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-(N-methylsulfonylanilino)acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-(N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 3542360 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-(N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc(NC(=O)CN(c2ccccc2)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C17H20N2O5S/c1-23-15-10-9-13(11-16(15)24-2)18-17(20)12-19(25(3,21)22)14-7-5-4-6-8-14/h4-11H,12H2,1-3H3,(H,18,20) |
| InChIKey | PAFPRMDTHVVNBE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |