C21H24N3O2S+ — CID 9211245
N-ethyl-N-phenyl-6-[[(1R)-1-phenylethyl]amino]pyridin-1-ium-3-sulfonamide (PubChem CID 9211245) has the molecular formula C21H24N3O2S+ and a molecular weight of 382.51 g/mol. Its IUPAC name is N-ethyl-N-phenyl-6-[[(1R)-1-phenylethyl]amino]pyridin-1-ium-3-sulfonamide.
| Compound Name | N-ethyl-N-phenyl-6-[[(1R)-1-phenylethyl]amino]pyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 9211245 |
| Molecular Formula | C21H24N3O2S+ |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-ethyl-N-phenyl-6-[[(1R)-1-phenylethyl]amino]pyridin-1-ium-3-sulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(N[C@H](C)c2ccccc2)[nH+]c1 |
| InChI | InChI=1S/C21H23N3O2S/c1-3-24(19-12-8-5-9-13-19)27(25,26)20-14-15-21(22-16-20)23-17(2)18-10-6-4-7-11-18/h4-17H,3H2,1-2H3,(H,22,23)/p+1/t17-/m1/s1 |
| InChIKey | ATHBPOAKVAYEMV-QGZVFWFLSA-O |
| XLogP | 3.89 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |