C13H21N4O3S+ — CID 9113716
N,N-diethyl-6-(3-oxopiperazin-1-yl)pyridin-1-ium-3-sulfonamide (PubChem CID 9113716) has the molecular formula C13H21N4O3S+ and a molecular weight of 313.40 g/mol. Its IUPAC name is N,N-diethyl-6-(3-oxopiperazin-1-yl)pyridin-1-ium-3-sulfonamide.
| Compound Name | N,N-diethyl-6-(3-oxopiperazin-1-yl)pyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 9113716 |
| Molecular Formula | C13H21N4O3S+ |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N,N-diethyl-6-(3-oxopiperazin-1-yl)pyridin-1-ium-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCNC(=O)C2)[nH+]c1 |
| InChI | InChI=1S/C13H20N4O3S/c1-3-17(4-2)21(19,20)11-5-6-12(15-9-11)16-8-7-14-13(18)10-16/h5-6,9H,3-4,7-8,10H2,1-2H3,(H,14,18)/p+1 |
| InChIKey | SZEKVZITIIGQOJ-UHFFFAOYSA-O |
| XLogP | -0.53 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |