C16H26N3O2S+ — CID 2118390
2-[(2R)-2-methylpiperidin-1-yl]-5-piperidin-1-ylsulfonylpyridin-1-ium (PubChem CID 2118390) has the molecular formula C16H26N3O2S+ and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-[(2R)-2-methylpiperidin-1-yl]-5-piperidin-1-ylsulfonylpyridin-1-ium.
| Compound Name | 2-[(2R)-2-methylpiperidin-1-yl]-5-piperidin-1-ylsulfonylpyridin-1-ium |
|---|---|
| PubChem CID | 2118390 |
| Molecular Formula | C16H26N3O2S+ |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 2-[(2R)-2-methylpiperidin-1-yl]-5-piperidin-1-ylsulfonylpyridin-1-ium |
| SMILES | C[C@@H]1CCCCN1c1ccc(S(=O)(=O)N2CCCCC2)c[nH+]1 |
| InChI | InChI=1S/C16H25N3O2S/c1-14-7-3-6-12-19(14)16-9-8-15(13-17-16)22(20,21)18-10-4-2-5-11-18/h8-9,13-14H,2-7,10-12H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | ZDDAPVAXPISLEQ-CQSZACIVSA-O |
| XLogP | 2.05 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |