C20H20ClN3O2S — CID 50806744
N-[(2-chlorophenyl)methyl]-6-pyrrolidin-1-ylsulfonylquinolin-2-amine (PubChem CID 50806744) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-6-pyrrolidin-1-ylsulfonylquinolin-2-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-6-pyrrolidin-1-ylsulfonylquinolin-2-amine |
|---|---|
| PubChem CID | 50806744 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-6-pyrrolidin-1-ylsulfonylquinolin-2-amine |
| SMILES | O=S(=O)(c1ccc2nc(NCc3ccccc3Cl)ccc2c1)N1CCCC1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-18-6-2-1-5-16(18)14-22-20-10-7-15-13-17(8-9-19(15)23-20)27(25,26)24-11-3-4-12-24/h1-2,5-10,13H,3-4,11-12,14H2,(H,22,23) |
| InChIKey | PMLNYMRNIBZNPV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |