C25H29N3O2S — CID 46283416
2-(4-benzylpiperidin-1-yl)-6-pyrrolidin-1-ylsulfonylquinoline (PubChem CID 46283416) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-6-pyrrolidin-1-ylsulfonylquinoline.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-6-pyrrolidin-1-ylsulfonylquinoline |
|---|---|
| PubChem CID | 46283416 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-6-pyrrolidin-1-ylsulfonylquinoline |
| SMILES | O=S(=O)(c1ccc2nc(N3CCC(Cc4ccccc4)CC3)ccc2c1)N1CCCC1 |
| InChI | InChI=1S/C25H29N3O2S/c29-31(30,28-14-4-5-15-28)23-9-10-24-22(19-23)8-11-25(26-24)27-16-12-21(13-17-27)18-20-6-2-1-3-7-20/h1-3,6-11,19,21H,4-5,12-18H2 |
| InChIKey | IMZPELKNYYMNIL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |