C20H27N3O2S — CID 92887045
6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-2-piperidin-1-ylquinoline (PubChem CID 92887045) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-2-piperidin-1-ylquinoline.
| Compound Name | 6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-2-piperidin-1-ylquinoline |
|---|---|
| PubChem CID | 92887045 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-2-piperidin-1-ylquinoline |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)c1ccc2nc(N3CCCCC3)ccc2c1 |
| InChI | InChI=1S/C20H27N3O2S/c1-16-7-3-6-14-23(16)26(24,25)18-9-10-19-17(15-18)8-11-20(21-19)22-12-4-2-5-13-22/h8-11,15-16H,2-7,12-14H2,1H3/t16-/m1/s1 |
| InChIKey | MASZISSBJZMRCT-MRXNPFEDSA-N |
| XLogP | 3.79 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |