C23H25N3O2S — CID 92887015
2-(2,3-dihydroindol-1-yl)-6-[(2R)-2-methylpiperidin-1-yl]sulfonylquinoline (PubChem CID 92887015) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-6-[(2R)-2-methylpiperidin-1-yl]sulfonylquinoline.
| Compound Name | 2-(2,3-dihydroindol-1-yl)-6-[(2R)-2-methylpiperidin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 92887015 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-6-[(2R)-2-methylpiperidin-1-yl]sulfonylquinoline |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)c1ccc2nc(N3CCc4ccccc43)ccc2c1 |
| InChI | InChI=1S/C23H25N3O2S/c1-17-6-4-5-14-26(17)29(27,28)20-10-11-21-19(16-20)9-12-23(24-21)25-15-13-18-7-2-3-8-22(18)25/h2-3,7-12,16-17H,4-6,13-15H2,1H3/t17-/m1/s1 |
| InChIKey | AUQURLKMUMJYRR-QGZVFWFLSA-N |
| XLogP | 4.49 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |