C24H27N3O4S — CID 92887011
ethyl 3-[[6-[(2S)-2-methylpiperidin-1-yl]sulfonylquinolin-2-yl]amino]benzoate (PubChem CID 92887011) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is ethyl 3-[[6-[(2S)-2-methylpiperidin-1-yl]sulfonylquinolin-2-yl]amino]benzoate.
| Compound Name | ethyl 3-[[6-[(2S)-2-methylpiperidin-1-yl]sulfonylquinolin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 92887011 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | ethyl 3-[[6-[(2S)-2-methylpiperidin-1-yl]sulfonylquinolin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ccc3cc(S(=O)(=O)N4CCCC[C@@H]4C)ccc3n2)c1 |
| InChI | InChI=1S/C24H27N3O4S/c1-3-31-24(28)19-8-6-9-20(15-19)25-23-13-10-18-16-21(11-12-22(18)26-23)32(29,30)27-14-5-4-7-17(27)2/h6,8-13,15-17H,3-5,7,14H2,1-2H3,(H,25,26)/t17-/m0/s1 |
| InChIKey | LOLLEEAJJSYIPO-KRWDZBQOSA-N |
| XLogP | 4.72 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |