C13H18N4O2S2 — CID 99966649
[6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-1,3-benzothiazol-2-yl]hydrazine (PubChem CID 99966649) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is [6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-1,3-benzothiazol-2-yl]hydrazine.
| Compound Name | [6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-1,3-benzothiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 99966649 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-1,3-benzothiazol-2-yl]hydrazine |
| SMILES | C[C@@H]1CCCCN1S(=O)(=O)c1ccc2nc(NN)sc2c1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-9-4-2-3-7-17(9)21(18,19)10-5-6-11-12(8-10)20-13(15-11)16-14/h5-6,8-9H,2-4,7,14H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | UHTGNPYFWYUKIS-SECBINFHSA-N |
| XLogP | 2.14 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|