C14H17N3O2S2 — CID 62143884
N-methyl-6-thiomorpholin-4-ylsulfonylquinolin-2-amine (PubChem CID 62143884) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-methyl-6-thiomorpholin-4-ylsulfonylquinolin-2-amine.
| Compound Name | N-methyl-6-thiomorpholin-4-ylsulfonylquinolin-2-amine |
|---|---|
| PubChem CID | 62143884 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | N-methyl-6-thiomorpholin-4-ylsulfonylquinolin-2-amine |
| SMILES | CNc1ccc2cc(S(=O)(=O)N3CCSCC3)ccc2n1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-15-14-5-2-11-10-12(3-4-13(11)16-14)21(18,19)17-6-8-20-9-7-17/h2-5,10H,6-9H2,1H3,(H,15,16) |
| InChIKey | ZULVDLKPADCUJB-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |