C17H24N3O2S+ — CID 9251563
N,N-diethyl-6-[(2-methylphenyl)methylamino]pyridin-1-ium-3-sulfonamide (PubChem CID 9251563) has the molecular formula C17H24N3O2S+ and a molecular weight of 334.47 g/mol. Its IUPAC name is N,N-diethyl-6-[(2-methylphenyl)methylamino]pyridin-1-ium-3-sulfonamide.
| Compound Name | N,N-diethyl-6-[(2-methylphenyl)methylamino]pyridin-1-ium-3-sulfonamide |
|---|---|
| PubChem CID | 9251563 |
| Molecular Formula | C17H24N3O2S+ |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | N,N-diethyl-6-[(2-methylphenyl)methylamino]pyridin-1-ium-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NCc2ccccc2C)[nH+]c1 |
| InChI | InChI=1S/C17H23N3O2S/c1-4-20(5-2)23(21,22)16-10-11-17(19-13-16)18-12-15-9-7-6-8-14(15)3/h6-11,13H,4-5,12H2,1-3H3,(H,18,19)/p+1 |
| InChIKey | UYJMPBAYITWBLQ-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |