C17H19N5O5S — CID 4239689
2-morpholin-4-ylsulfonyl-4-nitro-N-(1-pyridin-4-ylethylideneamino)aniline (PubChem CID 4239689) has the molecular formula C17H19N5O5S and a molecular weight of 405.44 g/mol. Its IUPAC name is 2-morpholin-4-ylsulfonyl-4-nitro-N-(1-pyridin-4-ylethylideneamino)aniline.
| Compound Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-(1-pyridin-4-ylethylideneamino)aniline |
|---|---|
| PubChem CID | 4239689 |
| Molecular Formula | C17H19N5O5S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 2-morpholin-4-ylsulfonyl-4-nitro-N-(1-pyridin-4-ylethylideneamino)aniline |
| SMILES | CC(=NNc1ccc([N+](=O)[O-])cc1S(=O)(=O)N1CCOCC1)c1ccncc1 |
| InChI | InChI=1S/C17H19N5O5S/c1-13(14-4-6-18-7-5-14)19-20-16-3-2-15(22(23)24)12-17(16)28(25,26)21-8-10-27-11-9-21/h2-7,12,20H,8-11H2,1H3 |
| InChIKey | LYIGQZFYWRQJKP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|