C16H13N5O3S — CID 9338829
4-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanyl-3-nitrobenzaldehyde (PubChem CID 9338829) has the molecular formula C16H13N5O3S and a molecular weight of 355.38 g/mol. Its IUPAC name is 4-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanyl-3-nitrobenzaldehyde.
| Compound Name | 4-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanyl-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 9338829 |
| Molecular Formula | C16H13N5O3S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanyl-3-nitrobenzaldehyde |
| SMILES | Cc1cccc(-n2nnnc2Sc2ccc(C=O)cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C16H13N5O3S/c1-10-4-3-5-13(11(10)2)20-16(17-18-19-20)25-15-7-6-12(9-22)8-14(15)21(23)24/h3-9H,1-2H3 |
| InChIKey | FQHJHAAVNSDDIA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|