C21H23N7O3S — CID 36623267
2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 36623267) has the molecular formula C21H23N7O3S and a molecular weight of 453.53 g/mol. Its IUPAC name is 2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 36623267 |
| Molecular Formula | C21H23N7O3S |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | 2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanyl-1-[4-(2-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1cccc(-n2nnnc2SCC(=O)N2CCN(c3ccccc3[N+](=O)[O-])CC2)c1C |
| InChI | InChI=1S/C21H23N7O3S/c1-15-6-5-9-17(16(15)2)27-21(22-23-24-27)32-14-20(29)26-12-10-25(11-13-26)18-7-3-4-8-19(18)28(30)31/h3-9H,10-14H2,1-2H3 |
| InChIKey | GDTDWNLZZIYLLA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|