C19H21N7O3S2 — CID 24572551
1-[4-(2-nitrophenyl)piperazin-1-yl]-2-[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 24572551) has the molecular formula C19H21N7O3S2 and a molecular weight of 459.56 g/mol. Its IUPAC name is 1-[4-(2-nitrophenyl)piperazin-1-yl]-2-[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-[4-(2-nitrophenyl)piperazin-1-yl]-2-[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 24572551 |
| Molecular Formula | C19H21N7O3S2 |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 1-[4-(2-nitrophenyl)piperazin-1-yl]-2-[1-(2-thiophen-2-ylethyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | O=C(CSc1nnnn1CCc1cccs1)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H21N7O3S2/c27-18(14-31-19-20-21-22-25(19)8-7-15-4-3-13-30-15)24-11-9-23(10-12-24)16-5-1-2-6-17(16)26(28)29/h1-6,13H,7-12,14H2 |
| InChIKey | FSQYKAWIYMKESO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|