C17H22N6O3S — CID 31405608
1-[4-(2-nitrophenyl)piperazin-1-yl]-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 31405608) has the molecular formula C17H22N6O3S and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-[4-(2-nitrophenyl)piperazin-1-yl]-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[4-(2-nitrophenyl)piperazin-1-yl]-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 31405608 |
| Molecular Formula | C17H22N6O3S |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-[4-(2-nitrophenyl)piperazin-1-yl]-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | CC(C)n1cnnc1SCC(=O)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H22N6O3S/c1-13(2)22-12-18-19-17(22)27-11-16(24)21-9-7-20(8-10-21)14-5-3-4-6-15(14)23(25)26/h3-6,12-13H,7-11H2,1-2H3 |
| InChIKey | ZQJFSWZKCUMFNW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|