C18H24N6O3S — CID 48733252
1-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 48733252) has the molecular formula C18H24N6O3S and a molecular weight of 404.50 g/mol. Its IUPAC name is 1-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 48733252 |
| Molecular Formula | C18H24N6O3S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 1-[4-[(3-nitrophenyl)methyl]piperazin-1-yl]-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | CC(C)n1cnnc1SCC(=O)N1CCN(Cc2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C18H24N6O3S/c1-14(2)23-13-19-20-18(23)28-12-17(25)22-8-6-21(7-9-22)11-15-4-3-5-16(10-15)24(26)27/h3-5,10,13-14H,6-9,11-12H2,1-2H3 |
| InChIKey | BRVWQMSJDOTIEH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|