C13H12F3N5O3S — CID 24508487
5-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1-(oxolan-2-ylmethyl)tetrazole (PubChem CID 24508487) has the molecular formula C13H12F3N5O3S and a molecular weight of 375.33 g/mol. Its IUPAC name is 5-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1-(oxolan-2-ylmethyl)tetrazole.
| Compound Name | 5-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1-(oxolan-2-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 24508487 |
| Molecular Formula | C13H12F3N5O3S |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 5-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1-(oxolan-2-ylmethyl)tetrazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Sc1nnnn1CC1CCCO1 |
| InChI | InChI=1S/C13H12F3N5O3S/c14-13(15,16)8-3-4-11(10(6-8)21(22)23)25-12-17-18-19-20(12)7-9-2-1-5-24-9/h3-4,6,9H,1-2,5,7H2 |
| InChIKey | NKFILBZDOBTTAS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|