C13H12FN5OS — CID 51322515
2-fluoro-6-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylbenzonitrile (PubChem CID 51322515) has the molecular formula C13H12FN5OS and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-fluoro-6-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylbenzonitrile.
| Compound Name | 2-fluoro-6-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 51322515 |
| Molecular Formula | C13H12FN5OS |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-fluoro-6-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylbenzonitrile |
| SMILES | N#Cc1c(F)cccc1Sc1nnnn1CC1CCCO1 |
| InChI | InChI=1S/C13H12FN5OS/c14-11-4-1-5-12(10(11)7-15)21-13-16-17-18-19(13)8-9-3-2-6-20-9/h1,4-5,9H,2-3,6,8H2 |
| InChIKey | BFLYSVVBQGAGBY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |