C15H18FN5O2S — CID 43052771
N-(2-fluorophenyl)-3-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide (PubChem CID 43052771) has the molecular formula C15H18FN5O2S and a molecular weight of 351.41 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide.
| Compound Name | N-(2-fluorophenyl)-3-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 43052771 |
| Molecular Formula | C15H18FN5O2S |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(2-fluorophenyl)-3-[1-(oxolan-2-ylmethyl)tetrazol-5-yl]sulfanylpropanamide |
| SMILES | O=C(CCSc1nnnn1CC1CCCO1)Nc1ccccc1F |
| InChI | InChI=1S/C15H18FN5O2S/c16-12-5-1-2-6-13(12)17-14(22)7-9-24-15-18-19-20-21(15)10-11-4-3-8-23-11/h1-2,5-6,11H,3-4,7-10H2,(H,17,22) |
| InChIKey | GLUUWWOTPYCKRQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |