C16H20N4O6 — CID 121333742
(3,4-dinitrophenyl)-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 121333742) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is (3,4-dinitrophenyl)-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (3,4-dinitrophenyl)-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121333742 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (3,4-dinitrophenyl)-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])c([N+](=O)[O-])c1)N1CCN(CC2CCCO2)CC1 |
| InChI | InChI=1S/C16H20N4O6/c21-16(12-3-4-14(19(22)23)15(10-12)20(24)25)18-7-5-17(6-8-18)11-13-2-1-9-26-13/h3-4,10,13H,1-2,5-9,11H2 |
| InChIKey | VIBPBSKQCKGTBG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|