C17H23N5O2 — CID 121333740
(2-amino-3H-benzimidazol-5-yl)-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 121333740) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2-amino-3H-benzimidazol-5-yl)-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (2-amino-3H-benzimidazol-5-yl)-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 121333740 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (2-amino-3H-benzimidazol-5-yl)-[4-(oxolan-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | Nc1nc2ccc(C(=O)N3CCN(CC4CCCO4)CC3)cc2[nH]1 |
| InChI | InChI=1S/C17H23N5O2/c18-17-19-14-4-3-12(10-15(14)20-17)16(23)22-7-5-21(6-8-22)11-13-2-1-9-24-13/h3-4,10,13H,1-2,5-9,11H2,(H3,18,19,20) |
| InChIKey | ZMLIYAMJZIRXGY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |