C14H12N4O6S — CID 40987282
[(3R)-2-oxooxolan-3-yl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 40987282) has the molecular formula C14H12N4O6S and a molecular weight of 364.34 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 40987282 |
| Molecular Formula | C14H12N4O6S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)O[C@@H]2CCOC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N4O6S/c1-17-7-15-16-14(17)25-11-3-2-8(6-9(11)18(21)22)12(19)24-10-4-5-23-13(10)20/h2-3,6-7,10H,4-5H2,1H3/t10-/m1/s1 |
| InChIKey | MWVZMXGYFDIXLM-SNVBAGLBSA-N |
| XLogP | 1.35 |
| TPSA | 126.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|