C18H15BrN4O5S — CID 2443530
2-(4-bromophenoxy)ethyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate (PubChem CID 2443530) has the molecular formula C18H15BrN4O5S and a molecular weight of 479.31 g/mol. Its IUPAC name is 2-(4-bromophenoxy)ethyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate.
| Compound Name | 2-(4-bromophenoxy)ethyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 2443530 |
| Molecular Formula | C18H15BrN4O5S |
| Molecular Weight | 479.31 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | 2-(4-bromophenoxy)ethyl 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzoate |
| SMILES | Cn1cnnc1Sc1ccc(C(=O)OCCOc2ccc(Br)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15BrN4O5S/c1-22-11-20-21-18(22)29-16-7-2-12(10-15(16)23(25)26)17(24)28-9-8-27-14-5-3-13(19)4-6-14/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | BAPJWMQFRPQWCK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 109.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|