C21H22N6O3S — CID 55452861
(4-methyl-2-phenylpiperazin-1-yl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone (PubChem CID 55452861) has the molecular formula C21H22N6O3S and a molecular weight of 438.51 g/mol. Its IUPAC name is (4-methyl-2-phenylpiperazin-1-yl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone.
| Compound Name | (4-methyl-2-phenylpiperazin-1-yl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 55452861 |
| Molecular Formula | C21H22N6O3S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | (4-methyl-2-phenylpiperazin-1-yl)-[4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methanone |
| SMILES | CN1CCN(C(=O)c2ccc(Sc3nncn3C)c([N+](=O)[O-])c2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C21H22N6O3S/c1-24-10-11-26(18(13-24)15-6-4-3-5-7-15)20(28)16-8-9-19(17(12-16)27(29)30)31-21-23-22-14-25(21)2/h3-9,12,14,18H,10-11,13H2,1-2H3 |
| InChIKey | WRFGXBRSKFGSPI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|