C12H12N6O5S — CID 170761487
methyl 2-[1-(2-formamidoethyl)tetrazol-5-yl]sulfanyl-5-nitrobenzoate (PubChem CID 170761487) has the molecular formula C12H12N6O5S and a molecular weight of 352.33 g/mol. Its IUPAC name is methyl 2-[1-(2-formamidoethyl)tetrazol-5-yl]sulfanyl-5-nitrobenzoate.
| Compound Name | methyl 2-[1-(2-formamidoethyl)tetrazol-5-yl]sulfanyl-5-nitrobenzoate |
|---|---|
| PubChem CID | 170761487 |
| Molecular Formula | C12H12N6O5S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | methyl 2-[1-(2-formamidoethyl)tetrazol-5-yl]sulfanyl-5-nitrobenzoate |
| SMILES | COC(=O)c1cc([N+](=O)[O-])ccc1Sc1nnnn1CCNC=O |
| InChI | InChI=1S/C12H12N6O5S/c1-23-11(20)9-6-8(18(21)22)2-3-10(9)24-12-14-15-16-17(12)5-4-13-7-19/h2-3,6-7H,4-5H2,1H3,(H,13,19) |
| InChIKey | KRCCKKCKWKNHHB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|