C16H15F2NO4S — CID 4813440
ethyl 5-[[4-(difluoromethoxy)benzoyl]amino]-3-methylthiophene-2-carboxylate (PubChem CID 4813440) has the molecular formula C16H15F2NO4S and a molecular weight of 355.36 g/mol. Its IUPAC name is ethyl 5-[[4-(difluoromethoxy)benzoyl]amino]-3-methylthiophene-2-carboxylate.
| Compound Name | ethyl 5-[[4-(difluoromethoxy)benzoyl]amino]-3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 4813440 |
| Molecular Formula | C16H15F2NO4S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | ethyl 5-[[4-(difluoromethoxy)benzoyl]amino]-3-methylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)c2ccc(OC(F)F)cc2)cc1C |
| InChI | InChI=1S/C16H15F2NO4S/c1-3-22-15(21)13-9(2)8-12(24-13)19-14(20)10-4-6-11(7-5-10)23-16(17)18/h4-8,16H,3H2,1-2H3,(H,19,20) |
| InChIKey | WZSSVBURTZHANS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |