C14H15N3O3S2 — CID 24569527
ethyl 3-methyl-5-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-2-carboxylate (PubChem CID 24569527) has the molecular formula C14H15N3O3S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is ethyl 3-methyl-5-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24569527 |
| Molecular Formula | C14H15N3O3S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | ethyl 3-methyl-5-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)CSc2ncccn2)cc1C |
| InChI | InChI=1S/C14H15N3O3S2/c1-3-20-13(19)12-9(2)7-11(22-12)17-10(18)8-21-14-15-5-4-6-16-14/h4-7H,3,8H2,1-2H3,(H,17,18) |
| InChIKey | CFVSAQXNXVFDHP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |