C24H32N4O2+2 — CID 8597268
2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]acetamide (PubChem CID 8597268) has the molecular formula C24H32N4O2+2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]acetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]acetamide |
|---|---|
| PubChem CID | 8597268 |
| Molecular Formula | C24H32N4O2+2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(3S)-1-benzylpyrrolidin-1-ium-3-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)c2ccccc2)CC1)N[C@H]1CC[NH+](Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H30N4O2/c29-23(25-22-11-12-27(18-22)17-20-7-3-1-4-8-20)19-26-13-15-28(16-14-26)24(30)21-9-5-2-6-10-21/h1-10,22H,11-19H2,(H,25,29)/p+2/t22-/m0/s1 |
| InChIKey | ATIXWMIISZYQPU-QFIPXVFZSA-P |
| XLogP | -1.00 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |