C22H27N2O2+ — CID 7411522
N-[1-[2-(4-methylphenyl)-2-oxoethyl]piperidin-1-ium-4-yl]-2-phenylacetamide (PubChem CID 7411522) has the molecular formula C22H27N2O2+ and a molecular weight of 351.47 g/mol. Its IUPAC name is N-[1-[2-(4-methylphenyl)-2-oxoethyl]piperidin-1-ium-4-yl]-2-phenylacetamide.
| Compound Name | N-[1-[2-(4-methylphenyl)-2-oxoethyl]piperidin-1-ium-4-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 7411522 |
| Molecular Formula | C22H27N2O2+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N-[1-[2-(4-methylphenyl)-2-oxoethyl]piperidin-1-ium-4-yl]-2-phenylacetamide |
| SMILES | Cc1ccc(C(=O)C[NH+]2CCC(NC(=O)Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O2/c1-17-7-9-19(10-8-17)21(25)16-24-13-11-20(12-14-24)23-22(26)15-18-5-3-2-4-6-18/h2-10,20H,11-16H2,1H3,(H,23,26)/p+1 |
| InChIKey | ZCIJPTXKFYVUNS-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |