C20H29FN3O2+ — CID 7411593
1-cyclohexyl-3-[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-1-ium-4-yl]urea (PubChem CID 7411593) has the molecular formula C20H29FN3O2+ and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-1-ium-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-1-ium-4-yl]urea |
|---|---|
| PubChem CID | 7411593 |
| Molecular Formula | C20H29FN3O2+ |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-cyclohexyl-3-[1-[2-(4-fluorophenyl)-2-oxoethyl]piperidin-1-ium-4-yl]urea |
| SMILES | O=C(NC1CCCCC1)NC1CC[NH+](CC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H28FN3O2/c21-16-8-6-15(7-9-16)19(25)14-24-12-10-18(11-13-24)23-20(26)22-17-4-2-1-3-5-17/h6-9,17-18H,1-5,10-14H2,(H2,22,23,26)/p+1 |
| InChIKey | XAQBWIBDAYCLCF-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |