C18H26FN2O+ — CID 7323463
N-cyclopentyl-1-[(4-fluorophenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 7323463) has the molecular formula C18H26FN2O+ and a molecular weight of 305.42 g/mol. Its IUPAC name is N-cyclopentyl-1-[(4-fluorophenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-cyclopentyl-1-[(4-fluorophenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7323463 |
| Molecular Formula | C18H26FN2O+ |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-cyclopentyl-1-[(4-fluorophenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | O=C(NC1CCCC1)C1CC[NH+](Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H25FN2O/c19-16-7-5-14(6-8-16)13-21-11-9-15(10-12-21)18(22)20-17-3-1-2-4-17/h5-8,15,17H,1-4,9-13H2,(H,20,22)/p+1 |
| InChIKey | SPSXAJDHDHXFAJ-UHFFFAOYSA-O |
| XLogP | 1.68 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |