C19H29N2O2+ — CID 6952865
N-cyclopentyl-1-[(3-methoxyphenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 6952865) has the molecular formula C19H29N2O2+ and a molecular weight of 317.45 g/mol. Its IUPAC name is N-cyclopentyl-1-[(3-methoxyphenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-cyclopentyl-1-[(3-methoxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6952865 |
| Molecular Formula | C19H29N2O2+ |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | N-cyclopentyl-1-[(3-methoxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | COc1cccc(C[NH+]2CCC(C(=O)NC3CCCC3)CC2)c1 |
| InChI | InChI=1S/C19H28N2O2/c1-23-18-8-4-5-15(13-18)14-21-11-9-16(10-12-21)19(22)20-17-6-2-3-7-17/h4-5,8,13,16-17H,2-3,6-7,9-12,14H2,1H3,(H,20,22)/p+1 |
| InChIKey | ZVYUZJJIKFSBTK-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |