C24H33N2O2+ — CID 6963584
N-tert-butyl-1-[(3-phenylmethoxyphenyl)methyl]piperidin-1-ium-4-carboxamide (PubChem CID 6963584) has the molecular formula C24H33N2O2+ and a molecular weight of 381.54 g/mol. Its IUPAC name is N-tert-butyl-1-[(3-phenylmethoxyphenyl)methyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-tert-butyl-1-[(3-phenylmethoxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6963584 |
| Molecular Formula | C24H33N2O2+ |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | N-tert-butyl-1-[(3-phenylmethoxyphenyl)methyl]piperidin-1-ium-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)C1CC[NH+](Cc2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C24H32N2O2/c1-24(2,3)25-23(27)21-12-14-26(15-13-21)17-20-10-7-11-22(16-20)28-18-19-8-5-4-6-9-19/h4-11,16,21H,12-15,17-18H2,1-3H3,(H,25,27)/p+1 |
| InChIKey | APLBXJBOVAPHKG-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |