C26H30N3O2+ — CID 6966321
1-[(4-phenylmethoxyphenyl)methyl]-N-(pyridin-2-ylmethyl)piperidin-1-ium-4-carboxamide (PubChem CID 6966321) has the molecular formula C26H30N3O2+ and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-[(4-phenylmethoxyphenyl)methyl]-N-(pyridin-2-ylmethyl)piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(4-phenylmethoxyphenyl)methyl]-N-(pyridin-2-ylmethyl)piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 6966321 |
| Molecular Formula | C26H30N3O2+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-[(4-phenylmethoxyphenyl)methyl]-N-(pyridin-2-ylmethyl)piperidin-1-ium-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)C1CC[NH+](Cc2ccc(OCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H29N3O2/c30-26(28-18-24-8-4-5-15-27-24)23-13-16-29(17-14-23)19-21-9-11-25(12-10-21)31-20-22-6-2-1-3-7-22/h1-12,15,23H,13-14,16-20H2,(H,28,30)/p+1 |
| InChIKey | IZVOIGIQIKQQTQ-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |