C26H37N3O2 — CID 3995388
N-[2-(diethylamino)ethyl]-1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 3995388) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(diethylamino)ethyl]-1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3995388 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | CCN(CC)CCNC(=O)C1CCN(Cc2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C26H37N3O2/c1-3-28(4-2)18-15-27-26(30)24-13-16-29(17-14-24)20-23-11-8-12-25(19-23)31-21-22-9-6-5-7-10-22/h5-12,19,24H,3-4,13-18,20-21H2,1-2H3,(H,27,30) |
| InChIKey | NONUIFBXSIXYFG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |