C21H32N3O3+ — CID 7411787
N-[1-[2-(cyclohexylamino)-2-oxoethyl]piperidin-1-ium-4-yl]-4-methoxybenzamide (PubChem CID 7411787) has the molecular formula C21H32N3O3+ and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[1-[2-(cyclohexylamino)-2-oxoethyl]piperidin-1-ium-4-yl]-4-methoxybenzamide.
| Compound Name | N-[1-[2-(cyclohexylamino)-2-oxoethyl]piperidin-1-ium-4-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7411787 |
| Molecular Formula | C21H32N3O3+ |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | N-[1-[2-(cyclohexylamino)-2-oxoethyl]piperidin-1-ium-4-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CC[NH+](CC(=O)NC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C21H31N3O3/c1-27-19-9-7-16(8-10-19)21(26)23-18-11-13-24(14-12-18)15-20(25)22-17-5-3-2-4-6-17/h7-10,17-18H,2-6,11-15H2,1H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | RRWWCXXTUZNZMF-UHFFFAOYSA-O |
| XLogP | 0.92 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |