C13H20N3O2+ — CID 6969782
N-(4-amino-2-methylphenyl)-2-morpholin-4-ium-4-ylacetamide (PubChem CID 6969782) has the molecular formula C13H20N3O2+ and a molecular weight of 250.32 g/mol. Its IUPAC name is N-(4-amino-2-methylphenyl)-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-(4-amino-2-methylphenyl)-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 6969782 |
| Molecular Formula | C13H20N3O2+ |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | N-(4-amino-2-methylphenyl)-2-morpholin-4-ium-4-ylacetamide |
| SMILES | Cc1cc(N)ccc1NC(=O)C[NH+]1CCOCC1 |
| InChI | InChI=1S/C13H19N3O2/c1-10-8-11(14)2-3-12(10)15-13(17)9-16-4-6-18-7-5-16/h2-3,8H,4-7,9,14H2,1H3,(H,15,17)/p+1 |
| InChIKey | ICIRQQCLYMQVPI-UHFFFAOYSA-O |
| XLogP | -0.57 |
| TPSA | 68.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|