C19H23N3OS — CID 7943944
2-[(2,3-dimethylphenyl)carbamothioyl-methylamino]-N-(4-methylphenyl)acetamide (PubChem CID 7943944) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenyl)carbamothioyl-methylamino]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(2,3-dimethylphenyl)carbamothioyl-methylamino]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 7943944 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[(2,3-dimethylphenyl)carbamothioyl-methylamino]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN(C)C(=S)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C19H23N3OS/c1-13-8-10-16(11-9-13)20-18(23)12-22(4)19(24)21-17-7-5-6-14(2)15(17)3/h5-11H,12H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | IGCIWVNNANTBFK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|