C15H22N2O2 — CID 27807926
N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methylbutanamide (PubChem CID 27807926) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methylbutanamide.
| Compound Name | N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methylbutanamide |
|---|---|
| PubChem CID | 27807926 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[2-(2,3-dimethylanilino)-2-oxoethyl]-N-methylbutanamide |
| SMILES | CCCC(=O)N(C)CC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C15H22N2O2/c1-5-7-15(19)17(4)10-14(18)16-13-9-6-8-11(2)12(13)3/h6,8-9H,5,7,10H2,1-4H3,(H,16,18) |
| InChIKey | IKEQVMOMZUVBAS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |